CAS 1246466-56-7 is the registry number for 5,6-Bis(trifluoromethyl)pyridin-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5,6-bis(trifluoromethyl)pyridin-2-amine (CAS 1246466-56-7) is a chemical compound with the molecular formula C7H4F6N2 and a molecular weight of 230.11 g/mol. IUPAC name: 5,6-bis(trifluoromethyl)pyridin-2-amine. InChIKey: OUHNLZRUVBDNMV-UHFFFAOYSA-N.
| Molecular formula | C7H4F6N2 |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 5,6-bis(trifluoromethyl)pyridin-2-amine |
| InChIKey | OUHNLZRUVBDNMV-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(F)(F)F)C(F)(F)F)N |
Computed by PubChem (NCBI)