CAS 116599-06-5 appears in our catalog under these names: 4-Ethylbenzene-1,2-diamine dihydrochloride, 95%, 4–Ethylbenzene–1,2–diamine dihydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
4-ethylbenzene-1,2-diamine;dihydrochloride (CAS 116599-06-5) is a chemical compound with the molecular formula C8H14Cl2N2 and a molecular weight of 209.11 g/mol. IUPAC name: 4-ethylbenzene-1,2-diamine;dihydrochloride. InChIKey: UUQDJQXMGZLMOO-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2 |
|---|---|
| Molecular weight | 209.11 g/mol |
| IUPAC name | 4-ethylbenzene-1,2-diamine;dihydrochloride |
| InChIKey | UUQDJQXMGZLMOO-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)