CAS 116601-09-3 appears in our catalog under these names: (2R,3R)-2,3-Dihydroxy-4-isopropoxy-4-oxobutanoic acid, 98%, Tartaric acid isopropyl ester, Tartaric acid isopropyl ester, min. 90 %, 50 mg, Tartaric acid isopropyl ester, min. 90 %, 100 mg, Tartaric acid isopropyl ester, min. 90 %, 250 mg. Offered by: Chemat Brand, Biosynth, Roth. Available pack sizes: on request, 0,1g, 0,05g, 0,25g, 0,5g, 1g, 50mg, 100mg.
(2R,3R)-2,3-dihydroxy-4-oxo-4-propan-2-yloxybutanoic acid (CAS 116601-09-3) is a chemical compound with the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxy-4-oxo-4-propan-2-yloxybutanoic acid. InChIKey: SSZYZSRPAKZEIB-RFZPGFLSSA-N.
| Molecular formula | C7H12O6 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxy-4-oxo-4-propan-2-yloxybutanoic acid |
| InChIKey | SSZYZSRPAKZEIB-RFZPGFLSSA-N |
| SMILES | CC(C)OC(=O)[C@@H]([C@H](C(=O)O)O)O |
Computed by PubChem (NCBI)