CAS 936335-24-9 is the registry number for (2R,3R)-2,3-Dihydroxy-2-methylbutanedioic Acid 1,4-Dimethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
Dimethyl (2R,3R)-2,3-dihydroxy-2-methylbutanedioate (CAS 936335-24-9) is a chemical compound with the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. IUPAC name: dimethyl (2R,3R)-2,3-dihydroxy-2-methylbutanedioate. InChIKey: NHRQHKGYVBJHQR-MHTLYPKNSA-N.
| Molecular formula | C7H12O6 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | dimethyl (2R,3R)-2,3-dihydroxy-2-methylbutanedioate |
| InChIKey | NHRQHKGYVBJHQR-MHTLYPKNSA-N |
| SMILES | C[C@@]([C@H](C(=O)OC)O)(C(=O)OC)O |
Computed by PubChem (NCBI)