Products 4068-87-5
CAS 4068-87-5 is the registry number for 2-C-methylene-myo-inositol oxide. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4S,5R,7S,8R)-1-oxaspiro[2.5]octane-4,5,6,7,8-pentol (CAS 4068-87-5) is a chemical compound with the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. IUPAC name: (4S,5R,7S,8R)-1-oxaspiro[2.5]octane-4,5,6,7,8-pentol. InChIKey: AWCFPDQAULWFNH-MVWKSXLKSA-N.
| Molecular formula | C7H12O6 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | (4S,5R,7S,8R)-1-oxaspiro[2.5]octane-4,5,6,7,8-pentol |
| InChIKey | AWCFPDQAULWFNH-MVWKSXLKSA-N |
| SMILES | C1C2(O1)[C@@H]([C@H](C([C@H]([C@@H]2O)O)O)O)O |
Computed by PubChem (NCBI)