CAS 116632-14-5 appears in our catalog under these names: 3–Iodonaphthalen–2–amine, 3-Iodonaphthalen-2-amine 97%, 3-Iodonaphthalen-2-amine, 98%, 98%, 3-Iodonaphthalen-2-amine, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
3-iodonaphthalen-2-amine (CAS 116632-14-5) is a chemical compound with the molecular formula C10H8IN and a molecular weight of 269.08 g/mol. IUPAC name: 3-iodonaphthalen-2-amine. InChIKey: KAOTXIGLMDOHJJ-UHFFFAOYSA-N.
| Molecular formula | C10H8IN |
|---|---|
| Molecular weight | 269.08 g/mol |
| IUPAC name | 3-iodonaphthalen-2-amine |
| InChIKey | KAOTXIGLMDOHJJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)N)I |
Computed by PubChem (NCBI)