CAS 116668-37-2 is the registry number for 3,4'-Dimethyl-[1,1'-biphenyl]-4-amine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-methyl-4-(4-methylphenyl)aniline (CAS 116668-37-2) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: 2-methyl-4-(4-methylphenyl)aniline. InChIKey: RHFXTYPJXCHYIG-UHFFFAOYSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | 2-methyl-4-(4-methylphenyl)aniline |
| InChIKey | RHFXTYPJXCHYIG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=C(C=C2)N)C |
Computed by PubChem (NCBI)