CAS 1166853-02-6 appears in our catalog under these names: 2-(Aminomethyl)-5-(4-chlorophenyl)thiophene hydrochloride, 95%, (5-(4-Chlorophenyl)thiophen-2-yl)methanamine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
[5-(4-chlorophenyl)thiophen-2-yl]methanamine;hydrochloride (CAS 1166853-02-6) is a chemical compound with the molecular formula C11H11Cl2NS and a molecular weight of 260.2 g/mol. IUPAC name: [5-(4-chlorophenyl)thiophen-2-yl]methanamine;hydrochloride. InChIKey: OGIWIXDYSIQBDS-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NS |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | [5-(4-chlorophenyl)thiophen-2-yl]methanamine;hydrochloride |
| InChIKey | OGIWIXDYSIQBDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(S2)CN)Cl.Cl |
Computed by PubChem (NCBI)