CAS 1211615-63-2 is the registry number for (4-Chlorophenyl)(thiophen-3-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4-chlorophenyl)-thiophen-3-ylmethanamine;hydrochloride (CAS 1211615-63-2) is a chemical compound with the molecular formula C11H11Cl2NS and a molecular weight of 260.2 g/mol. IUPAC name: (4-chlorophenyl)-thiophen-3-ylmethanamine;hydrochloride. InChIKey: VFPAYYKHIGXDPG-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NS |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | (4-chlorophenyl)-thiophen-3-ylmethanamine;hydrochloride |
| InChIKey | VFPAYYKHIGXDPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CSC=C2)N)Cl.Cl |
Computed by PubChem (NCBI)