CAS 2375273-77-9 is the registry number for 5-(Chloromethyl)-4-methyl-2-phenyl-1,3-thiazole hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-(chloromethyl)-4-methyl-2-phenyl-1,3-thiazole;hydrochloride (CAS 2375273-77-9) is a chemical compound with the molecular formula C11H11Cl2NS and a molecular weight of 260.2 g/mol. IUPAC name: 5-(chloromethyl)-4-methyl-2-phenyl-1,3-thiazole;hydrochloride. InChIKey: UTWGWXMKKLMRAX-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NS |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | 5-(chloromethyl)-4-methyl-2-phenyl-1,3-thiazole;hydrochloride |
| InChIKey | UTWGWXMKKLMRAX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=C2)CCl.Cl |
Computed by PubChem (NCBI)