Products 1167055-29-9
CAS 1167055-29-9 appears in our catalog under these names: 6–Chloropyrazolo(1，5–a)pyridine–3–carboxylic acid, 6-Chloropyrazolo[1,5-a]pyridine-3-carboxylic acid, 97%, 97%, 6-Chloropyrazolo[1,5-a]pyridine-3-carboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 25g, 10g.
6-chloropyrazolo[1,5-a]pyridine-3-carboxylic acid (CAS 1167055-29-9) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 6-chloropyrazolo[1,5-a]pyridine-3-carboxylic acid. InChIKey: YLAZZSDUXQKRDN-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 6-chloropyrazolo[1,5-a]pyridine-3-carboxylic acid |
| InChIKey | YLAZZSDUXQKRDN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NN2C=C1Cl)C(=O)O |
Computed by PubChem (NCBI)