CAS 116734-78-2 is the registry number for 3-Nitro-9-octyl-9H-carbazole 97%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-nitro-9-octylcarbazole (CAS 116734-78-2) is a chemical compound with the molecular formula C20H24N2O2 and a molecular weight of 324.4 g/mol. IUPAC name: 3-nitro-9-octylcarbazole. InChIKey: BPYJYAMCNGEZBK-UHFFFAOYSA-N.
| Molecular formula | C20H24N2O2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 3-nitro-9-octylcarbazole |
| InChIKey | BPYJYAMCNGEZBK-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN1C2=C(C=C(C=C2)[N+](=O)[O-])C3=CC=CC=C31 |
Computed by PubChem (NCBI)