Products 1167424-93-2
CAS 1167424-93-2 appears in our catalog under these names: tert-Butyl 6-benzyl-2,6-diazaspiro[3.3]heptane-2-carboxylate, 95%, 1-Boc-6-Benzyl-2,6-diazaspiro(3.3)heptane, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 6-benzyl-2,6-diazaspiro[3.3]heptane-2-carboxylate (CAS 1167424-93-2) is a chemical compound with the molecular formula C17H24N2O2 and a molecular weight of 288.4 g/mol. IUPAC name: tert-butyl 6-benzyl-2,6-diazaspiro[3.3]heptane-2-carboxylate. InChIKey: FRCCDRQRHLFSHZ-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O2 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | tert-butyl 6-benzyl-2,6-diazaspiro[3.3]heptane-2-carboxylate |
| InChIKey | FRCCDRQRHLFSHZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CN(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)