CAS 185559-52-8 is the registry number for tert-Butyl ((1r,5s,6s)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
Tert-butyl N-[(1R,5S)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl]carbamate (CAS 185559-52-8) is a chemical compound with the molecular formula C17H24N2O2 and a molecular weight of 288.4 g/mol. IUPAC name: tert-butyl N-[(1R,5S)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl]carbamate. InChIKey: JYIFMNXUMIYQHE-YIONKMFJSA-N.
| Molecular formula | C17H24N2O2 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | tert-butyl N-[(1R,5S)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl]carbamate |
| InChIKey | JYIFMNXUMIYQHE-YIONKMFJSA-N |
| SMILES | CC(C)(C)OC(=O)NC1[C@H]2[C@@H]1CN(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)