Products 1823467-33-9

CAS 1823467-33-9 is the registry number for 3-Benzylamino-8-aza-bicyclo[3.2.1]octane-8-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3-(benzylamino)-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 1823467-33-9) is a chemical compound with the molecular formula C17H24N2O2 and a molecular weight of 288.4 g/mol. IUPAC name: ethyl 3-(benzylamino)-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: OBEVUCFVGFDTEN-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24N2O2
Molecular weight288.4 g/mol
IUPAC nameethyl 3-(benzylamino)-8-azabicyclo[3.2.1]octane-8-carboxylate
InChIKeyOBEVUCFVGFDTEN-UHFFFAOYSA-N
SMILESCCOC(=O)N1C2CCC1CC(C2)NCC3=CC=CC=C3

Computed by PubChem (NCBI)