CAS 116751-24-7 appears in our catalog under these names: Moxifloxacin Impurity 68, 2,4,5–Trifluoro–3–hydroxybenzoic Acid, 3-Hydroxy-2,4,5-trifluorobenzoic acid, 2,4,5-Trifluoro-3-hydroxybenzoic Acid, >98.0%(GC)(T), 3-Hydroxy-2,4,5-trifluorobenzoic acid 98%. Offered by: Chemat Brand, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: on request, 100g, 25g, 500g, 5g, 250g, 1g, 10g.
2,4,5-trifluoro-3-hydroxybenzoic acid (CAS 116751-24-7) is a chemical compound with the molecular formula C7H3F3O3 and a molecular weight of 192.09 g/mol. IUPAC name: 2,4,5-trifluoro-3-hydroxybenzoic acid. InChIKey: YYAFUGSJSHXYNK-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O3 |
|---|---|
| Molecular weight | 192.09 g/mol |
| IUPAC name | 2,4,5-trifluoro-3-hydroxybenzoic acid |
| InChIKey | YYAFUGSJSHXYNK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)O)F)C(=O)O |
Computed by PubChem (NCBI)