CAS 38233-44-2 is the registry number for 2,3,4-Trifluoro-5-hydroxybenzoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2,3,4-trifluoro-5-hydroxybenzoic acid (CAS 38233-44-2) is a chemical compound with the molecular formula C7H3F3O3 and a molecular weight of 192.09 g/mol. IUPAC name: 2,3,4-trifluoro-5-hydroxybenzoic acid. InChIKey: SKYWKENXVVPEQG-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O3 |
|---|---|
| Molecular weight | 192.09 g/mol |
| IUPAC name | 2,3,4-trifluoro-5-hydroxybenzoic acid |
| InChIKey | SKYWKENXVVPEQG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1O)F)F)F)C(=O)O |
Computed by PubChem (NCBI)