CAS 116815-03-3 is the registry number for Tolvaptan Impurity 49. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-1,2,3,4-tetrahydro-1-benzazepin-5-one (CAS 116815-03-3) is a chemical compound with the molecular formula C10H10ClNO and a molecular weight of 195.64 g/mol. IUPAC name: 8-chloro-1,2,3,4-tetrahydro-1-benzazepin-5-one. InChIKey: VYAYCHCHFQVJHU-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | 8-chloro-1,2,3,4-tetrahydro-1-benzazepin-5-one |
| InChIKey | VYAYCHCHFQVJHU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=C(C=C2)Cl)NC1 |
Computed by PubChem (NCBI)