CAS 116817-86-8 is the registry number for Duloxetine maleate. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.
(Z)-but-2-enedioic acid;(3S)-N-methyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine (CAS 116817-86-8) is a chemical compound with the molecular formula C22H23NO5S and a molecular weight of 413.5 g/mol. IUPAC name: (Z)-but-2-enedioic acid;(3S)-N-methyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine. InChIKey: SJYDFHDOQMMHJX-HNUXRKMMSA-N.
| Molecular formula | C22H23NO5S |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;(3S)-N-methyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine |
| InChIKey | SJYDFHDOQMMHJX-HNUXRKMMSA-N |
| SMILES | CNCC[C@@H](C1=CC=CS1)OC2=CC=CC3=CC=CC=C32.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)