CAS 1881290-72-7 is the registry number for 4-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]benzene-1-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]benzenesulfonamide (CAS 1881290-72-7) is a chemical compound with the molecular formula C22H23NO5S and a molecular weight of 413.5 g/mol. IUPAC name: 4-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]benzenesulfonamide. InChIKey: IHSAMWQVDNZJOJ-UHFFFAOYSA-N.
| Molecular formula | C22H23NO5S |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | 4-hydroxy-N,N-bis[(4-methoxyphenyl)methyl]benzenesulfonamide |
| InChIKey | IHSAMWQVDNZJOJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN(CC2=CC=C(C=C2)OC)S(=O)(=O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)