CAS 959392-23-5 is the registry number for (3S)-N-Methyl-Gamma-(1-naphthalenyloxy)-3-thiophenepropanamine Maleic Acid Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
(E)-but-2-enedioic acid;(3S)-N-methyl-3-naphthalen-1-yloxy-3-thiophen-3-ylpropan-1-amine (CAS 959392-23-5) is a chemical compound with the molecular formula C22H23NO5S and a molecular weight of 413.5 g/mol. IUPAC name: (E)-but-2-enedioic acid;(3S)-N-methyl-3-naphthalen-1-yloxy-3-thiophen-3-ylpropan-1-amine. InChIKey: LIZDTEAWVJFBKR-QTNVCCTOSA-N.
| Molecular formula | C22H23NO5S |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;(3S)-N-methyl-3-naphthalen-1-yloxy-3-thiophen-3-ylpropan-1-amine |
| InChIKey | LIZDTEAWVJFBKR-QTNVCCTOSA-N |
| SMILES | CNCC[C@@H](C1=CSC=C1)OC2=CC=CC3=CC=CC=C32.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)