Products 159652-53-6
CAS 159652-53-6 is the registry number for (±)Phenserine. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate (CAS 159652-53-6) is a chemical compound with the molecular formula C20H23N3O2 and a molecular weight of 337.4 g/mol. IUPAC name: [(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate. InChIKey: PBHFNBQPZCRWQP-QUCCMNQESA-N.
| Molecular formula | C20H23N3O2 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | [(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate |
| InChIKey | PBHFNBQPZCRWQP-QUCCMNQESA-N |
| SMILES | C[C@@]12CCN([C@@H]1N(C3=C2C=C(C=C3)OC(=O)NC4=CC=CC=C4)C)C |
Computed by PubChem (NCBI)