CAS 116995-31-4 is the registry number for 1,3,5-trichloro-2-(propan-2-yloxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,3,5-trichloro-2-propan-2-yloxybenzene (CAS 116995-31-4) is a chemical compound with the molecular formula C9H9Cl3O and a molecular weight of 239.5 g/mol. IUPAC name: 1,3,5-trichloro-2-propan-2-yloxybenzene. InChIKey: NGHLOECEBHAJSF-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl3O |
|---|---|
| Molecular weight | 239.5 g/mol |
| IUPAC name | 1,3,5-trichloro-2-propan-2-yloxybenzene |
| InChIKey | NGHLOECEBHAJSF-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)