CAS 62436-52-6 is the registry number for 2-(2,4,5-Trichlorophenyl)propan-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(2,4,5-trichlorophenyl)propan-2-ol (CAS 62436-52-6) is a chemical compound with the molecular formula C9H9Cl3O and a molecular weight of 239.5 g/mol. IUPAC name: 2-(2,4,5-trichlorophenyl)propan-2-ol. InChIKey: XDPGORCCJPPGPA-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl3O |
|---|---|
| Molecular weight | 239.5 g/mol |
| IUPAC name | 2-(2,4,5-trichlorophenyl)propan-2-ol |
| InChIKey | XDPGORCCJPPGPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1Cl)Cl)Cl)O |
Computed by PubChem (NCBI)