CAS 2228138-85-8 is the registry number for 1-(2,4,6-Trichlorophenyl)propan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,4,6-trichlorophenyl)propan-2-ol (CAS 2228138-85-8) is a chemical compound with the molecular formula C9H9Cl3O and a molecular weight of 239.5 g/mol. IUPAC name: 1-(2,4,6-trichlorophenyl)propan-2-ol. InChIKey: NHJKERDCKOALCJ-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl3O |
|---|---|
| Molecular weight | 239.5 g/mol |
| IUPAC name | 1-(2,4,6-trichlorophenyl)propan-2-ol |
| InChIKey | NHJKERDCKOALCJ-UHFFFAOYSA-N |
| SMILES | CC(CC1=C(C=C(C=C1Cl)Cl)Cl)O |
Computed by PubChem (NCBI)