CAS 117-06-6 is the registry number for N-(5-Amino-9,10-dioxo-9,10-dihydroanthracen-1-yl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-amino-9,10-dioxoanthracen-1-yl)benzamide (CAS 117-06-6) is a chemical compound with the molecular formula C21H14N2O3 and a molecular weight of 342.3 g/mol. IUPAC name: N-(5-amino-9,10-dioxoanthracen-1-yl)benzamide. InChIKey: FWEQPMZEKHHFTB-UHFFFAOYSA-N.
| Molecular formula | C21H14N2O3 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | N-(5-amino-9,10-dioxoanthracen-1-yl)benzamide |
| InChIKey | FWEQPMZEKHHFTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=CC3=C2C(=O)C4=C(C3=O)C(=CC=C4)N |
Computed by PubChem (NCBI)