CAS 937605-22-6 is the registry number for 3-((3-Nitrophenyl)amino)-2-phenylinden-1-one. Offered by: Biosynth. Available pack sizes: 10g, 25g.
3-(3-nitroanilino)-2-phenylinden-1-one (CAS 937605-22-6) is a chemical compound with the molecular formula C21H14N2O3 and a molecular weight of 342.3 g/mol. IUPAC name: 3-(3-nitroanilino)-2-phenylinden-1-one. InChIKey: XBIBXZGGSXVBQK-UHFFFAOYSA-N.
| Molecular formula | C21H14N2O3 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 3-(3-nitroanilino)-2-phenylinden-1-one |
| InChIKey | XBIBXZGGSXVBQK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3C2=O)NC4=CC(=CC=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)