CAS 1309925-39-0 appears in our catalog under these names: Tubulin inhibitor 8/ 99.34% (existing batch purity), 10-(4-methoxybenzoyl)-10H-phenoxazine-3-carbonitrile, Tubulin inhibitor 8. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
10-(4-methoxybenzoyl)phenoxazine-3-carbonitrile (CAS 1309925-39-0) is a chemical compound with the molecular formula C21H14N2O3 and a molecular weight of 342.3 g/mol. IUPAC name: 10-(4-methoxybenzoyl)phenoxazine-3-carbonitrile. InChIKey: JNDAHXOWDRYLBK-UHFFFAOYSA-N.
| Molecular formula | C21H14N2O3 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 10-(4-methoxybenzoyl)phenoxazine-3-carbonitrile |
| InChIKey | JNDAHXOWDRYLBK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)N2C3=C(C=C(C=C3)C#N)OC4=CC=CC=C42 |
Computed by PubChem (NCBI)