Products 117-38-4
CAS 117-38-4 appears in our catalog under these names: Metamizole sodium EP Impurity E, Metamizole EP Impurity E. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 250mg, 100mg.
[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]methanesulfonic acid (CAS 117-38-4) is a chemical compound with the molecular formula C12H15N3O4S and a molecular weight of 297.33 g/mol. IUPAC name: [(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]methanesulfonic acid. InChIKey: VRESBCAKEFFDQB-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O4S |
|---|---|
| Molecular weight | 297.33 g/mol |
| IUPAC name | [(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]methanesulfonic acid |
| InChIKey | VRESBCAKEFFDQB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)NCS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Sulfamidopyrine, (Antipyrinylamino)methanesulfonic acid, SULFAMPYRINE, Methanesulfonic acid, (antipyrinylamino)-, Metamizole impurity E [USP-MC], Sulfamidopyrine [WHO-DD], Metamizole impurity E (USP-MC), METAMIZOLE SODIUM MONOHYDRATE IMPURITY E [EP IMPURITY], METAMIZOLE SODIUM MONOHYDRATE IMPURITY E (EP IMPURITY), [(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]methanesulfonic acid