CAS 53760-27-3 appears in our catalog under these names: N1-(4-Aminophenyl)benzene-1,4-diamine sulfate, 95%, N1–(4–Aminophenyl)benzene–1,4–diamine sulfate, 4,4'-Diaminodiphenylamine Sulfate, >97.0%(T), N1-(4-Aminophenyl)benzene-1,4-diamine sulfate 95%, N1-(4-Aminophenyl)benzene-1,4-diamine sulfate, >97.0%(T), >97.0%(T). Offered by: AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 25g, 500g, 100g, 1g.
4-N-(4-aminophenyl)benzene-1,4-diamine;sulfuric acid (CAS 53760-27-3) is a chemical compound with the molecular formula C12H15N3O4S and a molecular weight of 297.33 g/mol. IUPAC name: 4-N-(4-aminophenyl)benzene-1,4-diamine;sulfuric acid. InChIKey: OOZQLPDAELLDNY-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O4S |
|---|---|
| Molecular weight | 297.33 g/mol |
| IUPAC name | 4-N-(4-aminophenyl)benzene-1,4-diamine;sulfuric acid |
| InChIKey | OOZQLPDAELLDNY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)NC2=CC=C(C=C2)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)