CAS 1448345-60-5 appears in our catalog under these names: Albendazole sulfone–d3, Albendazole Sulfone-d3, Albendazole-sulphone-D3, D3-Albendazole-sulfone, Concentration: 100 µg/ml Solvent: Methanol, D3-Albendazole-sulfone. Offered by: GLPBio, Chemat Brand, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 5mg, on request, 1mg, 10mg, 25mg, 2mg, 1 mg, 5 mg.
Trideuteriomethyl N-(6-propylsulfonyl-1H-benzimidazol-2-yl)carbamate (CAS 1448345-60-5) is a chemical compound with the molecular formula C12H15N3O4S and a molecular weight of 300.35 g/mol. IUPAC name: trideuteriomethyl N-(6-propylsulfonyl-1H-benzimidazol-2-yl)carbamate. InChIKey: CLSJYOLYMZNKJB-BMSJAHLVSA-N.
| Molecular formula | C12H15N3O4S |
|---|---|
| Molecular weight | 300.35 g/mol |
| IUPAC name | trideuteriomethyl N-(6-propylsulfonyl-1H-benzimidazol-2-yl)carbamate |
| InChIKey | CLSJYOLYMZNKJB-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)NC1=NC2=C(N1)C=C(C=C2)S(=O)(=O)CCC |
Computed by PubChem (NCBI)