CAS 1170133-10-4 is the registry number for N-(2-Aminoethyl)-2,5-dimethylbenzene-1-sulfonamide hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(2-aminoethyl)-2,5-dimethylbenzenesulfonamide;hydrochloride (CAS 1170133-10-4) is a chemical compound with the molecular formula C10H17ClN2O2S and a molecular weight of 264.77 g/mol. IUPAC name: N-(2-aminoethyl)-2,5-dimethylbenzenesulfonamide;hydrochloride. InChIKey: HRIUJEFJHNOOLY-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2O2S |
|---|---|
| Molecular weight | 264.77 g/mol |
| IUPAC name | N-(2-aminoethyl)-2,5-dimethylbenzenesulfonamide;hydrochloride |
| InChIKey | HRIUJEFJHNOOLY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)NCCN.Cl |
Computed by PubChem (NCBI)