CAS 1803597-24-1 appears in our catalog under these names: N-(3-Aminobutyl)benzenesulfonamide hydrochloride, 95%, N-(3-Aminobutyl)benzenesulfonamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-(3-aminobutyl)benzenesulfonamide;hydrochloride (CAS 1803597-24-1) is a chemical compound with the molecular formula C10H17ClN2O2S and a molecular weight of 264.77 g/mol. IUPAC name: N-(3-aminobutyl)benzenesulfonamide;hydrochloride. InChIKey: QWRMILGLYLKTRP-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2O2S |
|---|---|
| Molecular weight | 264.77 g/mol |
| IUPAC name | N-(3-aminobutyl)benzenesulfonamide;hydrochloride |
| InChIKey | QWRMILGLYLKTRP-UHFFFAOYSA-N |
| SMILES | CC(CCNS(=O)(=O)C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)