CAS 1193389-49-9 is the registry number for 4-(1-Aminoethyl)-N,N-dimethylbenzene-1-sulfonamide hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-(1-aminoethyl)-N,N-dimethylbenzenesulfonamide;hydrochloride (CAS 1193389-49-9) is a chemical compound with the molecular formula C10H17ClN2O2S and a molecular weight of 264.77 g/mol. IUPAC name: 4-(1-aminoethyl)-N,N-dimethylbenzenesulfonamide;hydrochloride. InChIKey: MRKIKDNTSWAPDV-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2O2S |
|---|---|
| Molecular weight | 264.77 g/mol |
| IUPAC name | 4-(1-aminoethyl)-N,N-dimethylbenzenesulfonamide;hydrochloride |
| InChIKey | MRKIKDNTSWAPDV-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)S(=O)(=O)N(C)C)N.Cl |
Computed by PubChem (NCBI)