Products 117030-69-0
CAS 117030-69-0 is the registry number for 2-Oxo-2,3,4,5-tetrahydro-1H-1-benzazepine-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g, 2g.
2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-carboxylic acid (CAS 117030-69-0) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-carboxylic acid. InChIKey: WVABYIKIASMFFY-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-carboxylic acid |
| InChIKey | WVABYIKIASMFFY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)C(=O)O)NC(=O)C1 |
Computed by PubChem (NCBI)