CAS 1170522-30-1 is the registry number for 5-Nitro-1-propyl-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-nitro-1-propylpyrazole (CAS 1170522-30-1) is a chemical compound with the molecular formula C6H9N3O2 and a molecular weight of 155.15 g/mol. IUPAC name: 5-nitro-1-propylpyrazole. InChIKey: DYVUOKAQZXKGML-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O2 |
|---|---|
| Molecular weight | 155.15 g/mol |
| IUPAC name | 5-nitro-1-propylpyrazole |
| InChIKey | DYVUOKAQZXKGML-UHFFFAOYSA-N |
| SMILES | CCCN1C(=CC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)