Products 1170719-57-9

CAS 1170719-57-9 is the registry number for 5-(Methoxycarbonyl)furan-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methoxycarbonylfuran-3-carboxylic acid (CAS 1170719-57-9) is a chemical compound with the molecular formula C7H6O5 and a molecular weight of 170.12 g/mol. IUPAC name: 5-methoxycarbonylfuran-3-carboxylic acid. InChIKey: WJEKCCOEKJGSGX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6O5
Molecular weight170.12 g/mol
IUPAC name5-methoxycarbonylfuran-3-carboxylic acid
InChIKeyWJEKCCOEKJGSGX-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=CO1)C(=O)O

Computed by PubChem (NCBI)