Products 16534-78-4

CAS 16534-78-4 is the registry number for 2,3,6-trihydroxybenzoic acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,3,6-trihydroxybenzoic acid (CAS 16534-78-4) is a chemical compound with the molecular formula C7H6O5 and a molecular weight of 170.12 g/mol. IUPAC name: 2,3,6-trihydroxybenzoic acid. InChIKey: ADUSGJRADQMJGN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6O5
Molecular weight170.12 g/mol
IUPAC name2,3,6-trihydroxybenzoic acid
InChIKeyADUSGJRADQMJGN-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1O)C(=O)O)O)O

Computed by PubChem (NCBI)