CAS 16534-78-4 is the registry number for 2,3,6-trihydroxybenzoic acid. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,6-trihydroxybenzoic acid (CAS 16534-78-4) is a chemical compound with the molecular formula C7H6O5 and a molecular weight of 170.12 g/mol. IUPAC name: 2,3,6-trihydroxybenzoic acid. InChIKey: ADUSGJRADQMJGN-UHFFFAOYSA-N.
| Molecular formula | C7H6O5 |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 2,3,6-trihydroxybenzoic acid |
| InChIKey | ADUSGJRADQMJGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)C(=O)O)O)O |
Computed by PubChem (NCBI)