CAS 54576-44-2 appears in our catalog under these names: 2-Methylfuran-3,4-dicarboxylic acid, 95%, 2-Methylfuran-3,4-dicarboxylic acid 95+%, 2-Methylfuran-3,4-dicarboxylic acid, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg.
2-methylfuran-3,4-dicarboxylic acid (CAS 54576-44-2) is a chemical compound with the molecular formula C7H6O5 and a molecular weight of 170.12 g/mol. IUPAC name: 2-methylfuran-3,4-dicarboxylic acid. InChIKey: DMVWTHJBGHANLQ-UHFFFAOYSA-N.
| Molecular formula | C7H6O5 |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 2-methylfuran-3,4-dicarboxylic acid |
| InChIKey | DMVWTHJBGHANLQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CO1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)