CAS 1170812-59-5 is the registry number for 4-(Piperidin-1-ylphenyl)glyoxal hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-oxo-2-(4-piperidin-1-ylphenyl)acetaldehyde;hydrate (CAS 1170812-59-5) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: 2-oxo-2-(4-piperidin-1-ylphenyl)acetaldehyde;hydrate. InChIKey: SXNPLZQCYQRCGL-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 2-oxo-2-(4-piperidin-1-ylphenyl)acetaldehyde;hydrate |
| InChIKey | SXNPLZQCYQRCGL-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC=C(C=C2)C(=O)C=O.O |
Computed by PubChem (NCBI)