Products 1171017-97-2
CAS 1171017-97-2 appears in our catalog under these names: 5-Chloro-2-methoxybenzenecarboximidamide hydrochloride, 97%, 5-Chloro-2-methoxybenzimidamide hydrochloride, 98%. Offered by: Fluorochem, Chemat Brand. Available pack sizes: 250mg, on request.
5-chloro-2-methoxybenzenecarboximidamide;hydrochloride (CAS 1171017-97-2) is a chemical compound with the molecular formula C8H10Cl2N2O and a molecular weight of 221.08 g/mol. IUPAC name: 5-chloro-2-methoxybenzenecarboximidamide;hydrochloride. InChIKey: XBRYMHYDZCUVRZ-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2O |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 5-chloro-2-methoxybenzenecarboximidamide;hydrochloride |
| InChIKey | XBRYMHYDZCUVRZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)C(=N)N.Cl |
Computed by PubChem (NCBI)