CAS 1909316-38-6 appears in our catalog under these names: 4-chloro-n,n-dimethylpyridine-2-carboxamide hydrochloride, 95%, 4-Chloro-N,N-dimethylpyridine-2-carboxamide hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 0,5g.
4-chloro-N,N-dimethylpyridine-2-carboxamide;hydrochloride (CAS 1909316-38-6) is a chemical compound with the molecular formula C8H10Cl2N2O and a molecular weight of 221.08 g/mol. IUPAC name: 4-chloro-N,N-dimethylpyridine-2-carboxamide;hydrochloride. InChIKey: CENPVSIXVUNUBC-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2O |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 4-chloro-N,N-dimethylpyridine-2-carboxamide;hydrochloride |
| InChIKey | CENPVSIXVUNUBC-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=NC=CC(=C1)Cl.Cl |
Computed by PubChem (NCBI)