CAS 1173313-82-0 is the registry number for 2-(2-Chlorophenyl)-n'-hydroxyethanimidamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
2-(2-chlorophenyl)-N'-hydroxyethanimidamide;hydrochloride (CAS 1173313-82-0) is a chemical compound with the molecular formula C8H10Cl2N2O and a molecular weight of 221.08 g/mol. IUPAC name: 2-(2-chlorophenyl)-N'-hydroxyethanimidamide;hydrochloride. InChIKey: QOGKHBFDYOJPLT-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2O |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-N'-hydroxyethanimidamide;hydrochloride |
| InChIKey | QOGKHBFDYOJPLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C/C(=N/O)/N)Cl.Cl |
Computed by PubChem (NCBI)