CAS 1171080-45-7 appears in our catalog under these names: (2S,5R)–Benzyl 5–((benzyloxy)amino)piperidine–2–carboxylate oxalate, (2S,5R)-Benzyl 5-((benzyloxy)amino)piperidine-2-carboxylate oxalate 97%, (2S,5R)-Benzyl 5-((benzyloxy)amino)piperidine-2-carboxylate oxalate, 95%, 95%, (2S,5R)-Benzyl 5-((benzyloxy)amino)piperidine-2-carboxylate oxalate, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 100g.
Benzyl (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylate;oxalic acid (CAS 1171080-45-7) is a chemical compound with the molecular formula C22H26N2O7 and a molecular weight of 430.5 g/mol. IUPAC name: benzyl (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylate;oxalic acid. InChIKey: AMOSSTKBTVKFNW-VOMIJIAVSA-N.
| Molecular formula | C22H26N2O7 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | benzyl (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylate;oxalic acid |
| InChIKey | AMOSSTKBTVKFNW-VOMIJIAVSA-N |
| SMILES | C1C[C@H](NC[C@@H]1NOCC2=CC=CC=C2)C(=O)OCC3=CC=CC=C3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)