Products 1416134-44-5

CAS 1416134-44-5 is the registry number for (2S)–5–Benzyloxyaminopiperidin–2–carboxylic acid benzyl ester oxalic acid salt. Offered by: GLPBio. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 5-(phenylmethoxyamino)piperidine-2-carboxylate;oxalic acid (CAS 1416134-44-5) is a chemical compound with the molecular formula C22H26N2O7 and a molecular weight of 430.5 g/mol. IUPAC name: benzyl 5-(phenylmethoxyamino)piperidine-2-carboxylate;oxalic acid. InChIKey: AMOSSTKBTVKFNW-UHFFFAOYSA-N.

Identity
Molecular formulaC22H26N2O7
Molecular weight430.5 g/mol
IUPAC namebenzyl 5-(phenylmethoxyamino)piperidine-2-carboxylate;oxalic acid
InChIKeyAMOSSTKBTVKFNW-UHFFFAOYSA-N
SMILESC1CC(NCC1NOCC2=CC=CC=C2)C(=O)OCC3=CC=CC=C3.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)