Products 2225148-51-4
CAS 2225148-51-4 appears in our catalog under these names: Thalidomide–O–C8–COOH, Thalidomide-O-C8-COOH, Thalidomide-O-C8-COOH, 97.44%, 9-[[2-(2,6-Dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]oxy]nonanoic acid, ≥95%(HPLC). Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 100mg, 500mg, 2mg, 25mg, 50mg, 500 mg, 5 mg, 25 mg.
9-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxynonanoic acid (CAS 2225148-51-4) is a chemical compound with the molecular formula C22H26N2O7 and a molecular weight of 430.5 g/mol. IUPAC name: 9-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxynonanoic acid. InChIKey: JDVPWEYIVOQCDX-UHFFFAOYSA-N.
| Molecular formula | C22H26N2O7 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | 9-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxynonanoic acid |
| InChIKey | JDVPWEYIVOQCDX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCCCCCCCCC(=O)O |
Computed by PubChem (NCBI)