CAS 117121-27-4 is the registry number for 4-(Aminomethyl)-3-nitrobenzoic acid hydrochloride, 98%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
4-(aminomethyl)-3-nitrobenzoic acid;hydrochloride (CAS 117121-27-4) is a chemical compound with the molecular formula C8H9ClN2O4 and a molecular weight of 232.62 g/mol. IUPAC name: 4-(aminomethyl)-3-nitrobenzoic acid;hydrochloride. InChIKey: CALFPGANNNSJNR-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O4 |
|---|---|
| Molecular weight | 232.62 g/mol |
| IUPAC name | 4-(aminomethyl)-3-nitrobenzoic acid;hydrochloride |
| InChIKey | CALFPGANNNSJNR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])CN.Cl |
Computed by PubChem (NCBI)