CAS 16336-29-1 appears in our catalog under these names: H–Gly–ONp · HCl, H-Gly-ONp*HCl, H-Gly-ONP Hydrochloride. Offered by: GLPBio, Creative Peptides, TRC. Available pack sizes: 1g, 5g, 100mg, 500mg, 50mg.
(4-nitrophenyl) 2-aminoacetate;hydrochloride (CAS 16336-29-1) is a chemical compound with the molecular formula C8H9ClN2O4 and a molecular weight of 232.62 g/mol. IUPAC name: (4-nitrophenyl) 2-aminoacetate;hydrochloride. InChIKey: MGZZUFRFWPWALX-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O4 |
|---|---|
| Molecular weight | 232.62 g/mol |
| IUPAC name | (4-nitrophenyl) 2-aminoacetate;hydrochloride |
| InChIKey | MGZZUFRFWPWALX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=O)CN.Cl |
Computed by PubChem (NCBI)