Products 1881290-20-5
CAS 1881290-20-5 is the registry number for methyl 3-amino-4-nitrobenzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-amino-4-nitrobenzoate;hydrochloride (CAS 1881290-20-5) is a chemical compound with the molecular formula C8H9ClN2O4 and a molecular weight of 232.62 g/mol. IUPAC name: methyl 3-amino-4-nitrobenzoate;hydrochloride. InChIKey: WODFPOWBBRXYLM-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O4 |
|---|---|
| Molecular weight | 232.62 g/mol |
| IUPAC name | methyl 3-amino-4-nitrobenzoate;hydrochloride |
| InChIKey | WODFPOWBBRXYLM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)