Products 1171376-80-9
CAS 1171376-80-9 appears in our catalog under these names: 7–Chloro–2,8–dimethyl–4–hydrazinoquinoline hydrochloride, 7-Chloro-2,8-dimethyl-4-hydrazinoquinoline hydrochloride, ≥97%, ≥97%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 500mg.
(7-chloro-2,8-dimethylquinolin-4-yl)hydrazine;hydrochloride (CAS 1171376-80-9) is a chemical compound with the molecular formula C11H13Cl2N3 and a molecular weight of 258.14 g/mol. IUPAC name: (7-chloro-2,8-dimethylquinolin-4-yl)hydrazine;hydrochloride. InChIKey: OXXNXLJXPVSPCJ-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N3 |
|---|---|
| Molecular weight | 258.14 g/mol |
| IUPAC name | (7-chloro-2,8-dimethylquinolin-4-yl)hydrazine;hydrochloride |
| InChIKey | OXXNXLJXPVSPCJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC(=C(C2=N1)C)Cl)NN.Cl |
Computed by PubChem (NCBI)